C12H20ClNO3S2 — CID 103270087
5-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methylthiophene-2-sulfonamide (PubChem CID 103270087) has the molecular formula C12H20ClNO3S2 and a molecular weight of 325.88 g/mol. Its IUPAC name is 5-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103270087 |
| Molecular Formula | C12H20ClNO3S2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methylthiophene-2-sulfonamide |
| SMILES | CCC(CC)C(O)CNS(=O)(=O)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C12H20ClNO3S2/c1-4-9(5-2)10(15)7-14-19(16,17)11-6-8(3)12(13)18-11/h6,9-10,14-15H,4-5,7H2,1-3H3 |
| InChIKey | ZLALTAXGAIJSGO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |