C11H20Cl2N2O2S2 — CID 120711958
N-(2-amino-2-ethylbutyl)-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride (PubChem CID 120711958) has the molecular formula C11H20Cl2N2O2S2 and a molecular weight of 347.33 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120711958 |
| Molecular Formula | C11H20Cl2N2O2S2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1cc(C)c(Cl)s1.Cl |
| InChI | InChI=1S/C11H19ClN2O2S2.ClH/c1-4-11(13,5-2)7-14-18(15,16)9-6-8(3)10(12)17-9;/h6,14H,4-5,7,13H2,1-3H3;1H |
| InChIKey | IYTPIWVMOPEMTA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |