C10H16Cl2N2O2S2 — CID 120721094
5-chloro-4-methyl-N-(pyrrolidin-3-ylmethyl)thiophene-2-sulfonamide;hydrochloride (PubChem CID 120721094) has the molecular formula C10H16Cl2N2O2S2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 5-chloro-4-methyl-N-(pyrrolidin-3-ylmethyl)thiophene-2-sulfonamide;hydrochloride.
| Compound Name | 5-chloro-4-methyl-N-(pyrrolidin-3-ylmethyl)thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721094 |
| Molecular Formula | C10H16Cl2N2O2S2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 5-chloro-4-methyl-N-(pyrrolidin-3-ylmethyl)thiophene-2-sulfonamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)NCC2CCNC2)sc1Cl.Cl |
| InChI | InChI=1S/C10H15ClN2O2S2.ClH/c1-7-4-9(16-10(7)11)17(14,15)13-6-8-2-3-12-5-8;/h4,8,12-13H,2-3,5-6H2,1H3;1H |
| InChIKey | HFSDNTOXSKDTET-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |