C11H18ClN3O2S2 — CID 103100358
5-chloro-4-methyl-N-(2-piperazin-1-ylethyl)thiophene-2-sulfonamide (PubChem CID 103100358) has the molecular formula C11H18ClN3O2S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 5-chloro-4-methyl-N-(2-piperazin-1-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-4-methyl-N-(2-piperazin-1-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100358 |
| Molecular Formula | C11H18ClN3O2S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 5-chloro-4-methyl-N-(2-piperazin-1-ylethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCN2CCNCC2)sc1Cl |
| InChI | InChI=1S/C11H18ClN3O2S2/c1-9-8-10(18-11(9)12)19(16,17)14-4-7-15-5-2-13-3-6-15/h8,13-14H,2-7H2,1H3 |
| InChIKey | SLMGHAWRSBJTPG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |