C12H23N5O2S — CID 122565353
2-ethyl-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-3-sulfonamide (PubChem CID 122565353) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-ethyl-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-3-sulfonamide.
| Compound Name | 2-ethyl-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 122565353 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-ethyl-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-3-sulfonamide |
| SMILES | CCn1nc(C)cc1S(=O)(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C12H23N5O2S/c1-3-17-12(10-11(2)15-17)20(18,19)14-6-9-16-7-4-13-5-8-16/h10,13-14H,3-9H2,1-2H3 |
| InChIKey | HWFSTLOSKADLSI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |