C11H23Cl2N5O2S — CID 119966513
1-ethyl-N-(2-piperazin-1-ylethyl)imidazole-4-sulfonamide;dihydrochloride (PubChem CID 119966513) has the molecular formula C11H23Cl2N5O2S and a molecular weight of 360.31 g/mol. Its IUPAC name is 1-ethyl-N-(2-piperazin-1-ylethyl)imidazole-4-sulfonamide;dihydrochloride.
| Compound Name | 1-ethyl-N-(2-piperazin-1-ylethyl)imidazole-4-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119966513 |
| Molecular Formula | C11H23Cl2N5O2S |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-ethyl-N-(2-piperazin-1-ylethyl)imidazole-4-sulfonamide;dihydrochloride |
| SMILES | CCn1cnc(S(=O)(=O)NCCN2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C11H21N5O2S.2ClH/c1-2-15-9-11(13-10-15)19(17,18)14-5-8-16-6-3-12-4-7-16;;/h9-10,12,14H,2-8H2,1H3;2*1H |
| InChIKey | YILJHRKNCGFBKK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |