C11H21ClN4O2S — CID 120723340
1-ethyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]imidazole-4-sulfonamide;hydrochloride (PubChem CID 120723340) has the molecular formula C11H21ClN4O2S and a molecular weight of 308.84 g/mol. Its IUPAC name is 1-ethyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]imidazole-4-sulfonamide;hydrochloride.
| Compound Name | 1-ethyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]imidazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120723340 |
| Molecular Formula | C11H21ClN4O2S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-ethyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]imidazole-4-sulfonamide;hydrochloride |
| SMILES | CCn1cnc(S(=O)(=O)NCC[C@H]2CCCN2)c1.Cl |
| InChI | InChI=1S/C11H20N4O2S.ClH/c1-2-15-8-11(13-9-15)18(16,17)14-7-5-10-4-3-6-12-10;/h8-10,12,14H,2-7H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | WFYQSYVSCVDDMK-HNCPQSOCSA-N |
| XLogP | 0.75 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |