C11H19N3O2S — CID 104972646
1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-3-sulfonamide (PubChem CID 104972646) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-3-sulfonamide.
| Compound Name | 1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 104972646 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-methyl-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]pyrrole-3-sulfonamide |
| SMILES | Cn1ccc(S(=O)(=O)NCC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C11H19N3O2S/c1-14-8-5-11(9-14)17(15,16)13-7-4-10-3-2-6-12-10/h5,8-10,12-13H,2-4,6-7H2,1H3/t10-/m0/s1 |
| InChIKey | LOQSJMWEIPGNBJ-JTQLQIEISA-N |
| XLogP | 0.45 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |