C9H18ClN5O2S — CID 120876392
3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide;hydrochloride (PubChem CID 120876392) has the molecular formula C9H18ClN5O2S and a molecular weight of 295.80 g/mol. Its IUPAC name is 3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide;hydrochloride.
| Compound Name | 3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876392 |
| Molecular Formula | C9H18ClN5O2S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide;hydrochloride |
| SMILES | Cl.Cn1nncc1S(=O)(=O)NCC[C@H]1CCCN1 |
| InChI | InChI=1S/C9H17N5O2S.ClH/c1-14-9(7-11-13-14)17(15,16)12-6-4-8-3-2-5-10-8;/h7-8,10,12H,2-6H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | LQFNHIDJKYWXBC-DDWIOCJRSA-N |
| XLogP | -0.34 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |