C9H16BrN5O2S — CID 106467162
5-bromo-3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide (PubChem CID 106467162) has the molecular formula C9H16BrN5O2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106467162 |
| Molecular Formula | C9H16BrN5O2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5-bromo-3-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCC[C@H]1CCCN1 |
| InChI | InChI=1S/C9H16BrN5O2S/c1-15-9(8(10)13-14-15)18(16,17)12-6-4-7-3-2-5-11-7/h7,11-12H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | HBJRSYQMEVBRMO-SSDOTTSWSA-N |
| XLogP | -0.00 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |