C13H18Br2N2O2S — CID 114794097
2,5-dibromo-4-methyl-N-(2-pyrrolidin-2-ylethyl)benzenesulfonamide (PubChem CID 114794097) has the molecular formula C13H18Br2N2O2S and a molecular weight of 426.17 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(2-pyrrolidin-2-ylethyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(2-pyrrolidin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114794097 |
| Molecular Formula | C13H18Br2N2O2S |
| Molecular Weight | 426.17 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(2-pyrrolidin-2-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCCC2CCCN2)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O2S/c1-9-7-12(15)13(8-11(9)14)20(18,19)17-6-4-10-3-2-5-16-10/h7-8,10,16-17H,2-6H2,1H3 |
| InChIKey | QXZWUASFBPIWCP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |