C13H20BrClN2O2S — CID 120723543
2-bromo-4-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120723543) has the molecular formula C13H20BrClN2O2S and a molecular weight of 383.74 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-bromo-4-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120723543 |
| Molecular Formula | C13H20BrClN2O2S |
| Molecular Weight | 383.74 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 2-bromo-4-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCC[C@H]2CCCN2)c(Br)c1.Cl |
| InChI | InChI=1S/C13H19BrN2O2S.ClH/c1-10-4-5-13(12(14)9-10)19(17,18)16-8-6-11-3-2-7-15-11;/h4-5,9,11,15-16H,2-3,6-8H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | OYPPSWGTIOYTKA-RFVHGSKJSA-N |
| XLogP | 2.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |