C12H22BrN5O2S — CID 106609031
5-bromo-N-butyl-3-methyl-N-(pyrrolidin-2-ylmethyl)triazole-4-sulfonamide (PubChem CID 106609031) has the molecular formula C12H22BrN5O2S and a molecular weight of 380.31 g/mol. Its IUPAC name is 5-bromo-N-butyl-3-methyl-N-(pyrrolidin-2-ylmethyl)triazole-4-sulfonamide.
| Compound Name | 5-bromo-N-butyl-3-methyl-N-(pyrrolidin-2-ylmethyl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106609031 |
| Molecular Formula | C12H22BrN5O2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-bromo-N-butyl-3-methyl-N-(pyrrolidin-2-ylmethyl)triazole-4-sulfonamide |
| SMILES | CCCCN(CC1CCCN1)S(=O)(=O)c1c(Br)nnn1C |
| InChI | InChI=1S/C12H22BrN5O2S/c1-3-4-8-18(9-10-6-5-7-14-10)21(19,20)12-11(13)15-16-17(12)2/h10,14H,3-9H2,1-2H3 |
| InChIKey | IOFMVQUSDDKJBT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |