C13H20Br2N2O2S2 — CID 106609340
2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)thiophene-3-sulfonamide (PubChem CID 106609340) has the molecular formula C13H20Br2N2O2S2 and a molecular weight of 460.26 g/mol. Its IUPAC name is 2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106609340 |
| Molecular Formula | C13H20Br2N2O2S2 |
| Molecular Weight | 460.26 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | 2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)thiophene-3-sulfonamide |
| SMILES | CCCCN(CC1CCCN1)S(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H20Br2N2O2S2/c1-2-3-7-17(9-10-5-4-6-16-10)21(18,19)11-8-12(14)20-13(11)15/h8,10,16H,2-7,9H2,1H3 |
| InChIKey | HRHCJTBKLALXSL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |