C12H18Br2N2O2S2 — CID 79716659
2,5-dibromo-N-ethyl-N-(piperidin-4-ylmethyl)thiophene-3-sulfonamide (PubChem CID 79716659) has the molecular formula C12H18Br2N2O2S2 and a molecular weight of 446.23 g/mol. Its IUPAC name is 2,5-dibromo-N-ethyl-N-(piperidin-4-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-ethyl-N-(piperidin-4-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 79716659 |
| Molecular Formula | C12H18Br2N2O2S2 |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 443.92 |
| IUPAC Name | 2,5-dibromo-N-ethyl-N-(piperidin-4-ylmethyl)thiophene-3-sulfonamide |
| SMILES | CCN(CC1CCNCC1)S(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H18Br2N2O2S2/c1-2-16(8-9-3-5-15-6-4-9)20(17,18)10-7-11(13)19-12(10)14/h7,9,15H,2-6,8H2,1H3 |
| InChIKey | ZPZJCSAXNOYRHN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |