C6H15N3O2S — CID 104985745
(2S)-2-[2-(sulfamoylamino)ethyl]pyrrolidine (PubChem CID 104985745) has the molecular formula C6H15N3O2S and a molecular weight of 193.27 g/mol. Its IUPAC name is (2S)-2-[2-(sulfamoylamino)ethyl]pyrrolidine.
| Compound Name | (2S)-2-[2-(sulfamoylamino)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 104985745 |
| Molecular Formula | C6H15N3O2S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2S)-2-[2-(sulfamoylamino)ethyl]pyrrolidine |
| SMILES | NS(=O)(=O)NCC[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H15N3O2S/c7-12(10,11)9-5-3-6-2-1-4-8-6/h6,8-9H,1-5H2,(H2,7,10,11)/t6-/m0/s1 |
| InChIKey | JDRQIZHZFPNTQL-LURJTMIESA-N |
| XLogP | -1.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |