C11H22N2O4S2 — CID 104972737
1,1-dioxo-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]thiane-4-sulfonamide (PubChem CID 104972737) has the molecular formula C11H22N2O4S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]thiane-4-sulfonamide.
| Compound Name | 1,1-dioxo-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]thiane-4-sulfonamide |
|---|---|
| PubChem CID | 104972737 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1,1-dioxo-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]thiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCC[C@@H]2CCCN2)CC1 |
| InChI | InChI=1S/C11H22N2O4S2/c14-18(15)8-4-11(5-9-18)19(16,17)13-7-3-10-2-1-6-12-10/h10-13H,1-9H2/t10-/m0/s1 |
| InChIKey | SRVXIPRZPBPPBW-JTQLQIEISA-N |
| XLogP | -0.37 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |