C11H22ClNO4S2 — CID 107849074
N-(6-chlorohexyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 107849074) has the molecular formula C11H22ClNO4S2 and a molecular weight of 331.89 g/mol. Its IUPAC name is N-(6-chlorohexyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(6-chlorohexyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 107849074 |
| Molecular Formula | C11H22ClNO4S2 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(6-chlorohexyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCCCCCCCl)CC1 |
| InChI | InChI=1S/C11H22ClNO4S2/c12-7-3-1-2-4-8-13-19(16,17)11-5-9-18(14,15)10-6-11/h11,13H,1-10H2 |
| InChIKey | BOWMCVRDFKEOFY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|