C10H20ClNO4S2 — CID 66091585
N-(4-chloro-2-methylbutyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 66091585) has the molecular formula C10H20ClNO4S2 and a molecular weight of 317.86 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(4-chloro-2-methylbutyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 66091585 |
| Molecular Formula | C10H20ClNO4S2 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | CC(CCCl)CNS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20ClNO4S2/c1-9(2-5-11)8-12-18(15,16)10-3-6-17(13,14)7-4-10/h9-10,12H,2-8H2,1H3 |
| InChIKey | NBHVGDWLLQOYOY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|