C8H16ClNO4S2 — CID 61057903
3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]propane-1-sulfonamide (PubChem CID 61057903) has the molecular formula C8H16ClNO4S2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 61057903 |
| Molecular Formula | C8H16ClNO4S2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]propane-1-sulfonamide |
| SMILES | O=S1(=O)CCC(CNS(=O)(=O)CCCCl)C1 |
| InChI | InChI=1S/C8H16ClNO4S2/c9-3-1-4-16(13,14)10-6-8-2-5-15(11,12)7-8/h8,10H,1-7H2 |
| InChIKey | UCMSKRWOULCGFZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|