C10H13ClN2O4S2 — CID 61047462
2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 61047462) has the molecular formula C10H13ClN2O4S2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61047462 |
| Molecular Formula | C10H13ClN2O4S2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | O=S1(=O)CCC(CNS(=O)(=O)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C10H13ClN2O4S2/c11-10-9(2-1-4-12-10)19(16,17)13-6-8-3-5-18(14,15)7-8/h1-2,4,8,13H,3,5-7H2 |
| InChIKey | QGWYCAQIKNEKEX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|