C8H13N3O4S2 — CID 102692339
N-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102692339) has the molecular formula C8H13N3O4S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692339 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S1(=O)CCC(CNS(=O)(=O)c2ccn[nH]2)C1 |
| InChI | InChI=1S/C8H13N3O4S2/c12-16(13)4-2-7(6-16)5-10-17(14,15)8-1-3-9-11-8/h1,3,7,10H,2,4-6H2,(H,9,11) |
| InChIKey | ZZFSRYTVQDGJPX-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |