C5H12N2O4S2 — CID 86706430
1,1-dioxo-3-[(sulfamoylamino)methyl]thiolane (PubChem CID 86706430) has the molecular formula C5H12N2O4S2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,1-dioxo-3-[(sulfamoylamino)methyl]thiolane.
| Compound Name | 1,1-dioxo-3-[(sulfamoylamino)methyl]thiolane |
|---|---|
| PubChem CID | 86706430 |
| Molecular Formula | C5H12N2O4S2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 1,1-dioxo-3-[(sulfamoylamino)methyl]thiolane |
| SMILES | NS(=O)(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H12N2O4S2/c6-13(10,11)7-3-5-1-2-12(8,9)4-5/h5,7H,1-4H2,(H2,6,10,11) |
| InChIKey | MAJZIADXPBFMQN-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |