C8H13N3O3S — CID 102693146
N-[(3-hydroxycyclobutyl)methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102693146) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693146 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCC1CC(O)C1)c1ccn[nH]1 |
| InChI | InChI=1S/C8H13N3O3S/c12-7-3-6(4-7)5-10-15(13,14)8-1-2-9-11-8/h1-2,6-7,10,12H,3-5H2,(H,9,11) |
| InChIKey | QEDUVQPNLNJCGI-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |