C8H13N3O4S2 — CID 102691826
N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-pyrazole-5-sulfonamide (PubChem CID 102691826) has the molecular formula C8H13N3O4S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691826 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-pyrazole-5-sulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H13N3O4S2/c1-11(7-3-5-16(12,13)6-7)17(14,15)8-2-4-9-10-8/h2,4,7H,3,5-6H2,1H3,(H,9,10) |
| InChIKey | JRLQCWHXMSCHFM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |