C11H14BrNO4S2 — CID 47113368
4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide (PubChem CID 47113368) has the molecular formula C11H14BrNO4S2 and a molecular weight of 368.27 g/mol. Its IUPAC name is 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 47113368 |
| Molecular Formula | C11H14BrNO4S2 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrNO4S2/c1-13(10-6-7-18(14,15)8-10)19(16,17)11-4-2-9(12)3-5-11/h2-5,10H,6-8H2,1H3 |
| InChIKey | FGKWYCQMXHNDSU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |