C13H17NO6S2 — CID 26526849
methyl 4-[[(3S)-1,1-dioxothiolan-3-yl]-methylsulfamoyl]benzoate (PubChem CID 26526849) has the molecular formula C13H17NO6S2 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl 4-[[(3S)-1,1-dioxothiolan-3-yl]-methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[[(3S)-1,1-dioxothiolan-3-yl]-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 26526849 |
| Molecular Formula | C13H17NO6S2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | methyl 4-[[(3S)-1,1-dioxothiolan-3-yl]-methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(C)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO6S2/c1-14(11-7-8-21(16,17)9-11)22(18,19)12-5-3-10(4-6-12)13(15)20-2/h3-6,11H,7-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | GUEBMSOAFPKOTP-NSHDSACASA-N |
| XLogP | 0.28 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |