C19H28N2O5S2 — CID 55565647
4-[cyclohexyl(methyl)sulfamoyl]-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide (PubChem CID 55565647) has the molecular formula C19H28N2O5S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55565647 |
| Molecular Formula | C19H28N2O5S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)NCC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H28N2O5S2/c1-21(17-5-3-2-4-6-17)28(25,26)18-9-7-16(8-10-18)19(22)20-13-15-11-12-27(23,24)14-15/h7-10,15,17H,2-6,11-14H2,1H3,(H,20,22) |
| InChIKey | YVZQBFSQZVCHJM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |