C24H30N4O5S — CID 46494457
N-(2-amino-2-oxoethyl)-4-[[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]methyl]benzamide (PubChem CID 46494457) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46494457 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]methyl]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)NCc2ccc(C(=O)NCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C24H30N4O5S/c1-28(20-5-3-2-4-6-20)34(32,33)21-13-11-19(12-14-21)23(30)26-15-17-7-9-18(10-8-17)24(31)27-16-22(25)29/h7-14,20H,2-6,15-16H2,1H3,(H2,25,29)(H,26,30)(H,27,31) |
| InChIKey | GOZWELWORXRJCA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |