C13H14BrNO4S2 — CID 55913299
4-bromo-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzenesulfonamide (PubChem CID 55913299) has the molecular formula C13H14BrNO4S2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 55913299 |
| Molecular Formula | C13H14BrNO4S2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrNO4S2/c1-2-8-15(12-7-9-20(16,17)10-12)21(18,19)13-5-3-11(14)4-6-13/h1,3-6,12H,7-10H2 |
| InChIKey | WAMLLDZYPGULBD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|