C17H23NO4S2 — CID 60542288
N-(1,1-dioxothiolan-3-yl)-2,3,5,6-tetramethyl-N-prop-2-ynylbenzenesulfonamide (PubChem CID 60542288) has the molecular formula C17H23NO4S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,3,5,6-tetramethyl-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,3,5,6-tetramethyl-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 60542288 |
| Molecular Formula | C17H23NO4S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,3,5,6-tetramethyl-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C17H23NO4S2/c1-6-8-18(16-7-9-23(19,20)11-16)24(21,22)17-14(4)12(2)10-13(3)15(17)5/h1,10,16H,7-9,11H2,2-5H3 |
| InChIKey | OJBJIAGDONHUTO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|