C13H14BrNO3S2 — CID 79948140
5-bromo-N-(1,1-dioxothiolan-3-yl)-4-methyl-N-prop-2-ynylthiophene-2-carboxamide (PubChem CID 79948140) has the molecular formula C13H14BrNO3S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is 5-bromo-N-(1,1-dioxothiolan-3-yl)-4-methyl-N-prop-2-ynylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-4-methyl-N-prop-2-ynylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79948140 |
| Molecular Formula | C13H14BrNO3S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-4-methyl-N-prop-2-ynylthiophene-2-carboxamide |
| SMILES | C#CCN(C(=O)c1cc(C)c(Br)s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14BrNO3S2/c1-3-5-15(10-4-6-20(17,18)8-10)13(16)11-7-9(2)12(14)19-11/h1,7,10H,4-6,8H2,2H3 |
| InChIKey | XVORHJNGHHAIMO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|