C14H13BrClNO3S — CID 103764437
2-bromo-4-chloro-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzamide (PubChem CID 103764437) has the molecular formula C14H13BrClNO3S and a molecular weight of 390.69 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzamide.
| Compound Name | 2-bromo-4-chloro-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 103764437 |
| Molecular Formula | C14H13BrClNO3S |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | 2-bromo-4-chloro-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(C(=O)c1ccc(Cl)cc1Br)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H13BrClNO3S/c1-2-6-17(11-5-7-21(19,20)9-11)14(18)12-4-3-10(16)8-13(12)15/h1,3-4,8,11H,5-7,9H2 |
| InChIKey | LWCYMFIOZZNBQL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|