C14H13BrFNO3S — CID 106547010
3-bromo-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-prop-2-ynylbenzamide (PubChem CID 106547010) has the molecular formula C14H13BrFNO3S and a molecular weight of 374.23 g/mol. Its IUPAC name is 3-bromo-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-prop-2-ynylbenzamide.
| Compound Name | 3-bromo-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 106547010 |
| Molecular Formula | C14H13BrFNO3S |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 3-bromo-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(C(=O)c1cccc(Br)c1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H13BrFNO3S/c1-2-7-17(10-6-8-21(19,20)9-10)14(18)11-4-3-5-12(15)13(11)16/h1,3-5,10H,6-9H2 |
| InChIKey | BXKVDQYOIHGFCU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|