C14H16N2O4S — CID 103717714
N-(1,1-dioxothiolan-3-yl)-6-methyl-4-oxo-N-prop-2-ynyl-1H-pyridine-3-carboxamide (PubChem CID 103717714) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-methyl-4-oxo-N-prop-2-ynyl-1H-pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-methyl-4-oxo-N-prop-2-ynyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103717714 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-methyl-4-oxo-N-prop-2-ynyl-1H-pyridine-3-carboxamide |
| SMILES | C#CCN(C(=O)c1c[nH]c(C)cc1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O4S/c1-3-5-16(11-4-6-21(19,20)9-11)14(18)12-8-15-10(2)7-13(12)17/h1,7-8,11H,4-6,9H2,2H3,(H,15,17) |
| InChIKey | RONXDBDVRWXEKX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|