C10H13NO3S — CID 60948987
N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylprop-2-enamide (PubChem CID 60948987) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylprop-2-enamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylprop-2-enamide |
|---|---|
| PubChem CID | 60948987 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylprop-2-enamide |
| SMILES | C#CCN(C(=O)C=C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13NO3S/c1-3-6-11(10(12)4-2)9-5-7-15(13,14)8-9/h1,4,9H,2,5-8H2 |
| InChIKey | FOWJVQWCLCQTKF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|