C12H18N2O4S — CID 66237665
4-amino-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynyloxolane-3-carboxamide (PubChem CID 66237665) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-amino-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 66237665 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-amino-N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynyloxolane-3-carboxamide |
| SMILES | C#CCN(C(=O)C1COCC1N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H18N2O4S/c1-2-4-14(9-3-5-19(16,17)8-9)12(15)10-6-18-7-11(10)13/h1,9-11H,3-8,13H2 |
| InChIKey | DWMXVCREWQULEZ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|