C12H20N2O5S2 — CID 60953594
2-amino-N-(1,1-dioxothiolan-3-yl)-4-methylsulfonyl-N-prop-2-ynylbutanamide (PubChem CID 60953594) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothiolan-3-yl)-4-methylsulfonyl-N-prop-2-ynylbutanamide.
| Compound Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-4-methylsulfonyl-N-prop-2-ynylbutanamide |
|---|---|
| PubChem CID | 60953594 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-4-methylsulfonyl-N-prop-2-ynylbutanamide |
| SMILES | C#CCN(C(=O)C(N)CCS(C)(=O)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-3-6-14(10-4-8-21(18,19)9-10)12(15)11(13)5-7-20(2,16)17/h1,10-11H,4-9,13H2,2H3 |
| InChIKey | VAMBDTBWWXGQMI-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|