C11H15NO4S — CID 54876509
N-(1,1-dioxothiolan-3-yl)-3-oxo-N-prop-2-ynylbutanamide (PubChem CID 54876509) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-oxo-N-prop-2-ynylbutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-oxo-N-prop-2-ynylbutanamide |
|---|---|
| PubChem CID | 54876509 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-oxo-N-prop-2-ynylbutanamide |
| SMILES | C#CCN(C(=O)CC(C)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO4S/c1-3-5-12(11(14)7-9(2)13)10-4-6-17(15,16)8-10/h1,10H,4-8H2,2H3 |
| InChIKey | DZYNCXRNDBURCF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|