C16H15Cl2NO4S — CID 35122106
2,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 35122106) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 35122106 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N(Cc1ccco1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H15Cl2NO4S/c17-11-3-4-14(15(18)8-11)16(20)19(9-13-2-1-6-23-13)12-5-7-24(21,22)10-12/h1-4,6,8,12H,5,7,9-10H2/t12-/m1/s1 |
| InChIKey | OILIXSVRLQDLDL-GFCCVEGCSA-N |
| XLogP | 3.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |