C20H24ClNO5S — CID 2471363
4-(4-chloro-2-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)butanamide (PubChem CID 2471363) has the molecular formula C20H24ClNO5S and a molecular weight of 425.93 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 2471363 |
| Molecular Formula | C20H24ClNO5S |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)N(Cc1ccco1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H24ClNO5S/c1-15-12-16(21)6-7-19(15)27-10-3-5-20(23)22(13-18-4-2-9-26-18)17-8-11-28(24,25)14-17/h2,4,6-7,9,12,17H,3,5,8,10-11,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | SCCZFVOZOSQWAL-QGZVFWFLSA-N |
| XLogP | 3.62 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|