C13H22N2O4S2 — CID 60542629
N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylazepane-1-sulfonamide (PubChem CID 60542629) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylazepane-1-sulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 60542629 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-prop-2-ynylazepane-1-sulfonamide |
| SMILES | C#CCN(C1CCS(=O)(=O)C1)S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-2-8-15(13-7-11-20(16,17)12-13)21(18,19)14-9-5-3-4-6-10-14/h1,13H,3-12H2 |
| InChIKey | VNMLASJIRCZLOQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|