C11H20N2O6S2 — CID 60829293
2-[(1,1-dioxothiolan-3-yl)-piperidin-1-ylsulfonylamino]acetic acid (PubChem CID 60829293) has the molecular formula C11H20N2O6S2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-piperidin-1-ylsulfonylamino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-piperidin-1-ylsulfonylamino]acetic acid |
|---|---|
| PubChem CID | 60829293 |
| Molecular Formula | C11H20N2O6S2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-piperidin-1-ylsulfonylamino]acetic acid |
| SMILES | O=C(O)CN(C1CCS(=O)(=O)C1)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H20N2O6S2/c14-11(15)8-13(10-4-7-20(16,17)9-10)21(18,19)12-5-2-1-3-6-12/h10H,1-9H2,(H,14,15) |
| InChIKey | MRNBJCYRFWDMST-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |