C10H19NO6S2 — CID 54918049
2-[butylsulfonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 54918049) has the molecular formula C10H19NO6S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[butylsulfonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid.
| Compound Name | 2-[butylsulfonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 54918049 |
| Molecular Formula | C10H19NO6S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[butylsulfonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
| SMILES | CCCCS(=O)(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO6S2/c1-2-3-5-19(16,17)11(7-10(12)13)9-4-6-18(14,15)8-9/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | SZLAGRMCIDFVCZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |