C9H18N2O7S2 — CID 114814426
2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethylsulfamoyl)amino]acetic acid (PubChem CID 114814426) has the molecular formula C9H18N2O7S2 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethylsulfamoyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethylsulfamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 114814426 |
| Molecular Formula | C9H18N2O7S2 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethylsulfamoyl)amino]acetic acid |
| SMILES | COCCNS(=O)(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O7S2/c1-18-4-3-10-20(16,17)11(6-9(12)13)8-2-5-19(14,15)7-8/h8,10H,2-7H2,1H3,(H,12,13) |
| InChIKey | VKYLDECVVWMZJT-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|