C11H20N2O6S — CID 60838544
2-[(1,1-dioxothiolan-3-yl)-[2-(2-methoxyethylamino)-2-oxoethyl]amino]acetic acid (PubChem CID 60838544) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-[2-(2-methoxyethylamino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-[2-(2-methoxyethylamino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 60838544 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-[2-(2-methoxyethylamino)-2-oxoethyl]amino]acetic acid |
| SMILES | COCCNC(=O)CN(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O6S/c1-19-4-3-12-10(14)6-13(7-11(15)16)9-2-5-20(17,18)8-9/h9H,2-8H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | IJWBHXBYGUSAHT-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|