C12H22N2O6S — CID 104763782
2-[(1,1-dioxothiolan-3-yl)-(2-propan-2-yloxyethylcarbamoyl)amino]acetic acid (PubChem CID 104763782) has the molecular formula C12H22N2O6S and a molecular weight of 322.38 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(2-propan-2-yloxyethylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(2-propan-2-yloxyethylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 104763782 |
| Molecular Formula | C12H22N2O6S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(2-propan-2-yloxyethylcarbamoyl)amino]acetic acid |
| SMILES | CC(C)OCCNC(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N2O6S/c1-9(2)20-5-4-13-12(17)14(7-11(15)16)10-3-6-21(18,19)8-10/h9-10H,3-8H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | JAFHESCGFOKSRV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|