C12H24N2O3S — CID 110299715
1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(3-methylbutyl)urea (PubChem CID 110299715) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(3-methylbutyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 110299715 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(3-methylbutyl)urea |
| SMILES | CCN(C(=O)NCCC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24N2O3S/c1-4-14(11-6-8-18(16,17)9-11)12(15)13-7-5-10(2)3/h10-11H,4-9H2,1-3H3,(H,13,15) |
| InChIKey | HNJSYMUHVKTYSG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |