C16H24N2O5S — CID 108890803
1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]-1-ethylurea (PubChem CID 108890803) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]-1-ethylurea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]-1-ethylurea |
|---|---|
| PubChem CID | 108890803 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]-1-ethylurea |
| SMILES | CCOc1ccc(OCNC(=O)N(CC)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H24N2O5S/c1-3-18(13-9-10-24(20,21)11-13)16(19)17-12-23-15-7-5-14(6-8-15)22-4-2/h5-8,13H,3-4,9-12H2,1-2H3,(H,17,19) |
| InChIKey | XGAXUYPLWBTDLP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|