C16H20ClNO5S — CID 102566256
2-chloro-N-(1,1-dioxothiolan-3-yl)-N-[2-(4-ethoxyphenyl)-2-oxoethyl]acetamide (PubChem CID 102566256) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-[2-(4-ethoxyphenyl)-2-oxoethyl]acetamide.
| Compound Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-[2-(4-ethoxyphenyl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 102566256 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-[2-(4-ethoxyphenyl)-2-oxoethyl]acetamide |
| SMILES | CCOc1ccc(C(=O)CN(C(=O)CCl)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H20ClNO5S/c1-2-23-14-5-3-12(4-6-14)15(19)10-18(16(20)9-17)13-7-8-24(21,22)11-13/h3-6,13H,2,7-11H2,1H3 |
| InChIKey | AJAKPLZWXZTSCB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|